C16H18ClNO4S2 — CID 42812110
[4-chloro-2-[[propan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42812110) has the molecular formula C16H18ClNO4S2 and a molecular weight of 387.91 g/mol. Its IUPAC name is [4-chloro-2-[[propan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-chloro-2-[[propan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42812110 |
| Molecular Formula | C16H18ClNO4S2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | [4-chloro-2-[[propan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)N(Cc1cc(Cl)ccc1OS(C)(=O)=O)C(=O)c1cccs1 |
| InChI | InChI=1S/C16H18ClNO4S2/c1-11(2)18(16(19)15-5-4-8-23-15)10-12-9-13(17)6-7-14(12)22-24(3,20)21/h4-9,11H,10H2,1-3H3 |
| InChIKey | CNKXBQGARYWTKE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|