C24H25ClN2O5S2 — CID 93304466
[2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] 4-acetamidobenzenesulfonate (PubChem CID 93304466) has the molecular formula C24H25ClN2O5S2 and a molecular weight of 521.06 g/mol. Its IUPAC name is [2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93304466 |
| Molecular Formula | C24H25ClN2O5S2 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | [2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1cc(Cl)ccc1OS(=O)(=O)c1ccc(NC(C)=O)cc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C24H25ClN2O5S2/c1-4-16(2)27(24(29)23-6-5-13-33-23)15-18-14-19(25)7-12-22(18)32-34(30,31)21-10-8-20(9-11-21)26-17(3)28/h5-14,16H,4,15H2,1-3H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | ULGBAUBOTLTLRO-INIZCTEOSA-N |
| XLogP | 5.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|