C23H23Cl2NO5S2 — CID 98421307
[5-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 98421307) has the molecular formula C23H23Cl2NO5S2 and a molecular weight of 528.48 g/mol. Its IUPAC name is [5-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 98421307 |
| Molecular Formula | C23H23Cl2NO5S2 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | [5-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1)C(=O)c1cccs1 |
| InChI | InChI=1S/C23H23Cl2NO5S2/c1-4-15(2)26(23(27)22-6-5-11-32-22)14-16-7-10-20(30-3)21(12-16)31-33(28,29)17-8-9-18(24)19(25)13-17/h5-13,15H,4,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | FQTLQPSGUOUPBT-HNNXBMFYSA-N |
| XLogP | 6.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|