About CID 69259223
CID 69259223 (PubChem CID 69259223) has the molecular formula C9H13KNOS
and a molecular weight of 222.37 g/mol.
Molecular Properties
| Compound Name | CID 69259223 |
| PubChem CID | 69259223 |
| Molecular Formula | C9H13KNOS |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)c1cccs1.[K] |
| InChI | InChI=1S/C9H13NOS.K/c1-3-10(4-2)9(11)8-6-5-7-12-8;/h5-7H,3-4H2,1-2H3; |
| InChIKey | FPESLGINCMNWTM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 69259223 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69259223?
The IUPAC name of CID 69259223 (CID 69259223) is not available.
What is the SMILES notation for CID 69259223?
The canonical SMILES for CID 69259223 is CCN(CC)C(=O)c1cccs1.[K].
What is the InChIKey of CID 69259223?
The InChIKey is FPESLGINCMNWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS.K/c1-3-10(4-2)9(11)8-6-5-7-12-8;/h5-7H,3-4H2,1-2H3;.
What are the key properties of CID 69259223?
CID 69259223 has a molecular weight of 222.37 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69259223 is sourced from PubChem (CID 69259223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).