C9H13NOS — CID 134976041
3-deuterio-N,N-diethylthiophene-2-carboxamide (PubChem CID 134976041) has the molecular formula C9H13NOS and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-deuterio-N,N-diethylthiophene-2-carboxamide.
| Compound Name | 3-deuterio-N,N-diethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 134976041 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-deuterio-N,N-diethylthiophene-2-carboxamide |
| SMILES | [2H]c1ccsc1C(=O)N(CC)CC |
| InChI | InChI=1S/C9H13NOS/c1-3-10(4-2)9(11)8-6-5-7-12-8/h5-7H,3-4H2,1-2H3/i6D |
| InChIKey | WCCLKHNWHBFKDF-RAMDWTOOSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |