C12H17NO — CID 24798842
2,6-dideuterio-N,N-diethyl-4-methylbenzamide (PubChem CID 24798842) has the molecular formula C12H17NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2,6-dideuterio-N,N-diethyl-4-methylbenzamide.
| Compound Name | 2,6-dideuterio-N,N-diethyl-4-methylbenzamide |
|---|---|
| PubChem CID | 24798842 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.14 |
| IUPAC Name | 2,6-dideuterio-N,N-diethyl-4-methylbenzamide |
| SMILES | [2H]c1cc(C)cc([2H])c1C(=O)N(CC)CC |
| InChI | InChI=1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-10(3)7-9-11/h6-9H,4-5H2,1-3H3/i8D,9D |
| InChIKey | PUZORFQMRDHKBT-XETGXLELSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |