C21H25NO2 — CID 869554
N,N-diethyl-4-(2,4,6-trimethylbenzoyl)benzamide (PubChem CID 869554) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N,N-diethyl-4-(2,4,6-trimethylbenzoyl)benzamide.
| Compound Name | N,N-diethyl-4-(2,4,6-trimethylbenzoyl)benzamide |
|---|---|
| PubChem CID | 869554 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N,N-diethyl-4-(2,4,6-trimethylbenzoyl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-6-22(7-2)21(24)18-10-8-17(9-11-18)20(23)19-15(4)12-14(3)13-16(19)5/h8-13H,6-7H2,1-5H3 |
| InChIKey | IJUDGERWGNGOPM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |