C35H40N2O — CID 139567563
bis[4-(N-ethyl-2,4,6-trimethylanilino)phenyl]methanone (PubChem CID 139567563) has the molecular formula C35H40N2O and a molecular weight of 504.72 g/mol. Its IUPAC name is bis[4-(N-ethyl-2,4,6-trimethylanilino)phenyl]methanone.
| Compound Name | bis[4-(N-ethyl-2,4,6-trimethylanilino)phenyl]methanone |
|---|---|
| PubChem CID | 139567563 |
| Molecular Formula | C35H40N2O |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | bis[4-(N-ethyl-2,4,6-trimethylanilino)phenyl]methanone |
| SMILES | CCN(c1ccc(C(=O)c2ccc(N(CC)c3c(C)cc(C)cc3C)cc2)cc1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C35H40N2O/c1-9-36(33-25(5)19-23(3)20-26(33)6)31-15-11-29(12-16-31)35(38)30-13-17-32(18-14-30)37(10-2)34-27(7)21-24(4)22-28(34)8/h11-22H,9-10H2,1-8H3 |
| InChIKey | FHZVMIRDTCAQKJ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |