C20H26N2O — CID 19167686
N-[4-(diethylamino)phenyl]-2,4,6-trimethylbenzamide (PubChem CID 19167686) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2,4,6-trimethylbenzamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 19167686 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2,4,6-trimethylbenzamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-6-22(7-2)18-10-8-17(9-11-18)21-20(23)19-15(4)12-14(3)13-16(19)5/h8-13H,6-7H2,1-5H3,(H,21,23) |
| InChIKey | MEOAIIIHUIWUBV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|