C23H29N3O4 — CID 7434489
[2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 2,4,6-trimethylbenzoate (PubChem CID 7434489) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 2,4,6-trimethylbenzoate.
| Compound Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 7434489 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 2,4,6-trimethylbenzoate |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)COC(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-6-26(7-2)19-10-8-18(9-11-19)22(28)25-24-20(27)14-30-23(29)21-16(4)12-15(3)13-17(21)5/h8-13H,6-7,14H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | ZSPGCQJQERDKIX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|