C23H29N3O4 — CID 7433512
[2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2R)-2-phenylbutanoate (PubChem CID 7433512) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2R)-2-phenylbutanoate.
| Compound Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 7433512 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)OCC(=O)NNC(=O)c1ccc(N(CC)CC)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O4/c1-4-20(17-10-8-7-9-11-17)23(29)30-16-21(27)24-25-22(28)18-12-14-19(15-13-18)26(5-2)6-3/h7-15,20H,4-6,16H2,1-3H3,(H,24,27)(H,25,28)/t20-/m1/s1 |
| InChIKey | SZWWURJHYZQKAD-HXUWFJFHSA-N |
| XLogP | 3.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|