C23H30N4O6 — CID 71889032
[2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 71889032) has the molecular formula C23H30N4O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 71889032 |
| Molecular Formula | C23H30N4O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)COC(=O)[C@@H](NC(=O)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C23H30N4O6/c1-5-27(6-2)17-11-9-16(10-12-17)21(29)26-25-19(28)14-33-23(31)20(15(3)4)24-22(30)18-8-7-13-32-18/h7-13,15,20H,5-6,14H2,1-4H3,(H,24,30)(H,25,28)(H,26,29)/t20-/m0/s1 |
| InChIKey | CWYPDAZEDPMGAX-FQEVSTJZSA-N |
| XLogP | 1.88 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|