C18H21N5O4 — CID 7432805
[2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 7432805) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7432805 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)COC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C18H21N5O4/c1-3-23(4-2)14-7-5-13(6-8-14)17(25)22-21-16(24)12-27-18(26)15-11-19-9-10-20-15/h5-11H,3-4,12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | WCUKFNLJEIQFLG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|