C15H16N4O3 — CID 5035630
[2-[4-(dimethylamino)anilino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 5035630) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 5035630 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C15H16N4O3/c1-19(2)12-5-3-11(4-6-12)18-14(20)10-22-15(21)13-9-16-7-8-17-13/h3-9H,10H2,1-2H3,(H,18,20) |
| InChIKey | HAMXEJBEQKYDPA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|