C16H14Cl3N3O3 — CID 4257818
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 4257818) has the molecular formula C16H14Cl3N3O3 and a molecular weight of 402.67 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 4257818 |
| Molecular Formula | C16H14Cl3N3O3 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)c2ncc(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3N3O3/c1-22(2)10-5-3-9(4-6-10)21-12(23)8-25-16(24)15-14(19)13(18)11(17)7-20-15/h3-7H,8H2,1-2H3,(H,21,23) |
| InChIKey | OFOWXUROWWWMMK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|