C16H15Cl2N3O3 — CID 2092523
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 2092523) has the molecular formula C16H15Cl2N3O3 and a molecular weight of 368.22 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2092523 |
| Molecular Formula | C16H15Cl2N3O3 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O3/c1-21(2)12-5-3-11(4-6-12)20-14(22)9-24-16(23)10-7-13(17)15(18)19-8-10/h3-8H,9H2,1-2H3,(H,20,22) |
| InChIKey | UDGJXRNSNIYYIN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|