C17H18N2O6 — CID 23742067
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trihydroxybenzoate (PubChem CID 23742067) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 23742067 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3,4,5-trihydroxybenzoate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)c2cc(O)c(O)c(O)c2)cc1 |
| InChI | InChI=1S/C17H18N2O6/c1-19(2)12-5-3-11(4-6-12)18-15(22)9-25-17(24)10-7-13(20)16(23)14(21)8-10/h3-8,20-21,23H,9H2,1-2H3,(H,18,22) |
| InChIKey | XGUCDHRTIGGIHM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|