C19H22N2O3 — CID 2519415
[2-(3,5-dimethylanilino)-2-oxoethyl] 4-(dimethylamino)benzoate (PubChem CID 2519415) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-2-oxoethyl] 4-(dimethylamino)benzoate.
| Compound Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 2519415 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 4-(dimethylamino)benzoate |
| SMILES | Cc1cc(C)cc(NC(=O)COC(=O)c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C19H22N2O3/c1-13-9-14(2)11-16(10-13)20-18(22)12-24-19(23)15-5-7-17(8-6-15)21(3)4/h5-11H,12H2,1-4H3,(H,20,22) |
| InChIKey | DTOCKNTWZAJAGH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |