C18H22N4O2 — CID 30288485
N'-[4-(diethylamino)benzoyl]-6-methylpyridine-3-carbohydrazide (PubChem CID 30288485) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-[4-(diethylamino)benzoyl]-6-methylpyridine-3-carbohydrazide.
| Compound Name | N'-[4-(diethylamino)benzoyl]-6-methylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 30288485 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N'-[4-(diethylamino)benzoyl]-6-methylpyridine-3-carbohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)c2ccc(C)nc2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c1-4-22(5-2)16-10-8-14(9-11-16)17(23)20-21-18(24)15-7-6-13(3)19-12-15/h6-12H,4-5H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | PLWLWNAVXFTDMP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|