C17H18BrNO — CID 91416066
N-[(3-bromophenyl)methyl]-N-ethyl-4-methylbenzamide (PubChem CID 91416066) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-ethyl-4-methylbenzamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-ethyl-4-methylbenzamide |
|---|---|
| PubChem CID | 91416066 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-ethyl-4-methylbenzamide |
| SMILES | CCN(Cc1cccc(Br)c1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18BrNO/c1-3-19(12-14-5-4-6-16(18)11-14)17(20)15-9-7-13(2)8-10-15/h4-11H,3,12H2,1-2H3 |
| InChIKey | AKESSWODBAVKTB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |