C14H21BrN2O — CID 60694428
2-[(3-bromophenyl)methyl-methylamino]-N,N-diethylacetamide (PubChem CID 60694428) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(3-bromophenyl)methyl-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 60694428 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H21BrN2O/c1-4-17(5-2)14(18)11-16(3)10-12-7-6-8-13(15)9-12/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | IQVFEWZNRZWMFJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |