C14H19BrN2O3 — CID 61416607
3-[[(3-bromophenyl)methyl-methylcarbamoyl]-ethylamino]propanoic acid (PubChem CID 61416607) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 3-[[(3-bromophenyl)methyl-methylcarbamoyl]-ethylamino]propanoic acid.
| Compound Name | 3-[[(3-bromophenyl)methyl-methylcarbamoyl]-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61416607 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 3-[[(3-bromophenyl)methyl-methylcarbamoyl]-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)N(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O3/c1-3-17(8-7-13(18)19)14(20)16(2)10-11-5-4-6-12(15)9-11/h4-6,9H,3,7-8,10H2,1-2H3,(H,18,19) |
| InChIKey | HWMXNMXWWPMWLO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |