C27H30F2N2O4S — CID 46135490
[5-(diethylamino)-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 46135490) has the molecular formula C27H30F2N2O4S and a molecular weight of 516.61 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [5-(diethylamino)-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 46135490 |
| Molecular Formula | C27H30F2N2O4S |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [5-(diethylamino)-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccc(F)cc2)C(=O)c2cccc(F)c2)c(OS(=O)(=O)CC)c1 |
| InChI | InChI=1S/C27H30F2N2O4S/c1-4-30(5-2)25-15-12-22(26(17-25)35-36(33,34)6-3)19-31(18-20-10-13-23(28)14-11-20)27(32)21-8-7-9-24(29)16-21/h7-17H,4-6,18-19H2,1-3H3 |
| InChIKey | PRBZLKNSABDIEU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|