C21H24FNO5S — CID 71954855
[5-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate (PubChem CID 71954855) has the molecular formula C21H24FNO5S and a molecular weight of 421.49 g/mol. Its IUPAC name is [5-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate.
| Compound Name | [5-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
|---|---|
| PubChem CID | 71954855 |
| Molecular Formula | C21H24FNO5S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [5-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cc(CN(CC2CC2)C(=O)c2cccc(F)c2)ccc1OC |
| InChI | InChI=1S/C21H24FNO5S/c1-3-29(25,26)28-20-11-16(9-10-19(20)27-2)14-23(13-15-7-8-15)21(24)17-5-4-6-18(22)12-17/h4-6,9-12,15H,3,7-8,13-14H2,1-2H3 |
| InChIKey | UAJZHSAHUXVODV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|