C28H30F4N2O5S — CID 83274413
[5-(diethylamino)-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 83274413) has the molecular formula C28H30F4N2O5S and a molecular weight of 582.62 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-(diethylamino)-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 83274413 |
| Molecular Formula | C28H30F4N2O5S |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | [5-(diethylamino)-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccc(F)cc2)C(=O)COC)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H30F4N2O5S/c1-4-33(5-2)24-14-11-21(18-34(27(35)19-38-3)17-20-9-12-23(29)13-10-20)26(16-24)39-40(36,37)25-8-6-7-22(15-25)28(30,31)32/h6-16H,4-5,17-19H2,1-3H3 |
| InChIKey | WEKZLPVCICXKAD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|