C30H32ClF3N2O5S — CID 98442754
[2-[[(2-chlorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 98442754) has the molecular formula C30H32ClF3N2O5S and a molecular weight of 625.11 g/mol. Its IUPAC name is [2-[[(2-chlorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[(2-chlorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 98442754 |
| Molecular Formula | C30H32ClF3N2O5S |
| Molecular Weight | 625.11 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | [2-[[(2-chlorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2ccccc2Cl)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H32ClF3N2O5S/c1-3-35(4-2)23-15-14-21(28(18-23)41-42(38,39)25-11-7-9-22(17-25)30(32,33)34)19-36(20-24-10-8-16-40-24)29(37)26-12-5-6-13-27(26)31/h5-7,9,11-15,17-18,24H,3-4,8,10,16,19-20H2,1-2H3/t24-/m0/s1 |
| InChIKey | ZRTIJDGRYQYGRW-DEOSSOPVSA-N |
| XLogP | 6.79 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.11 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|