C28H42N4O5S — CID 46135780
[2-[[butan-2-yl(tert-butylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate (PubChem CID 46135780) has the molecular formula C28H42N4O5S and a molecular weight of 546.73 g/mol. Its IUPAC name is [2-[[butan-2-yl(tert-butylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[[butan-2-yl(tert-butylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 46135780 |
| Molecular Formula | C28H42N4O5S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | [2-[[butan-2-yl(tert-butylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(N(CC)CC)cc1OS(=O)(=O)c1ccc(NC(C)=O)cc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C28H42N4O5S/c1-9-20(4)32(27(34)30-28(6,7)8)19-22-12-15-24(31(10-2)11-3)18-26(22)37-38(35,36)25-16-13-23(14-17-25)29-21(5)33/h12-18,20H,9-11,19H2,1-8H3,(H,29,33)(H,30,34) |
| InChIKey | OCPHZHBKYNXKPR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|