C20H23ClFNO5S — CID 46135768
[4-chloro-2-[[(2-methoxyacetyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 46135768) has the molecular formula C20H23ClFNO5S and a molecular weight of 443.92 g/mol. Its IUPAC name is [4-chloro-2-[[(2-methoxyacetyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-chloro-2-[[(2-methoxyacetyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46135768 |
| Molecular Formula | C20H23ClFNO5S |
| Molecular Weight | 443.92 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [4-chloro-2-[[(2-methoxyacetyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCC(=O)N(Cc1cc(Cl)ccc1OS(=O)(=O)c1ccc(F)cc1)CC(C)C |
| InChI | InChI=1S/C20H23ClFNO5S/c1-14(2)11-23(20(24)13-27-3)12-15-10-16(21)4-9-19(15)28-29(25,26)18-7-5-17(22)6-8-18/h4-10,14H,11-13H2,1-3H3 |
| InChIKey | XQKBAAZEJASPCU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|