C26H19ClF3NO3 — CID 44759678
N-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(furan-2-ylmethyl)-3-(trifluoromethyl)benzamide (PubChem CID 44759678) has the molecular formula C26H19ClF3NO3 and a molecular weight of 485.89 g/mol. Its IUPAC name is N-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(furan-2-ylmethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(furan-2-ylmethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44759678 |
| Molecular Formula | C26H19ClF3NO3 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(furan-2-ylmethyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N(Cc1cccc(Oc2ccc(Cl)cc2)c1)Cc1ccco1 |
| InChI | InChI=1S/C26H19ClF3NO3/c27-21-9-11-22(12-10-21)34-23-7-1-4-18(14-23)16-31(17-24-8-3-13-33-24)25(32)19-5-2-6-20(15-19)26(28,29)30/h1-15H,16-17H2 |
| InChIKey | WXXKOMBMKFPJGT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |