C15H24N2O4S2 — CID 71647811
tert-butyl 3-[[methyl(thiophen-2-ylsulfonyl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 71647811) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl 3-[[methyl(thiophen-2-ylsulfonyl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[methyl(thiophen-2-ylsulfonyl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71647811 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | tert-butyl 3-[[methyl(thiophen-2-ylsulfonyl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(CC1CCN(C(=O)OC(C)(C)C)C1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H24N2O4S2/c1-15(2,3)21-14(18)17-8-7-12(11-17)10-16(4)23(19,20)13-6-5-9-22-13/h5-6,9,12H,7-8,10-11H2,1-4H3 |
| InChIKey | SMYYWGPKHUCPJB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |