C11H22N2O4S — CID 155681430
tert-butyl 3-[[methyl(methylsulfonyl)amino]methyl]azetidine-1-carboxylate (PubChem CID 155681430) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is tert-butyl 3-[[methyl(methylsulfonyl)amino]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[methyl(methylsulfonyl)amino]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 155681430 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | tert-butyl 3-[[methyl(methylsulfonyl)amino]methyl]azetidine-1-carboxylate |
| SMILES | CN(CC1CN(C(=O)OC(C)(C)C)C1)S(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O4S/c1-11(2,3)17-10(14)13-7-9(8-13)6-12(4)18(5,15)16/h9H,6-8H2,1-5H3 |
| InChIKey | JPDSVUXSAAFFOD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |