C14H28N2O4S — CID 126823140
tert-butyl 3-[[butyl(methyl)sulfamoyl]methyl]azetidine-1-carboxylate (PubChem CID 126823140) has the molecular formula C14H28N2O4S and a molecular weight of 320.46 g/mol. Its IUPAC name is tert-butyl 3-[[butyl(methyl)sulfamoyl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[butyl(methyl)sulfamoyl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 126823140 |
| Molecular Formula | C14H28N2O4S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | tert-butyl 3-[[butyl(methyl)sulfamoyl]methyl]azetidine-1-carboxylate |
| SMILES | CCCCN(C)S(=O)(=O)CC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N2O4S/c1-6-7-8-15(5)21(18,19)11-12-9-16(10-12)13(17)20-14(2,3)4/h12H,6-11H2,1-5H3 |
| InChIKey | BONLRIFAJKQUSV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |