C11H21NO5S2 — CID 142675756
tert-butyl (3R,4S)-3-hydroxy-4-(methylsulfonylsulfanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 142675756) has the molecular formula C11H21NO5S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-hydroxy-4-(methylsulfonylsulfanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-hydroxy-4-(methylsulfonylsulfanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142675756 |
| Molecular Formula | C11H21NO5S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | tert-butyl (3R,4S)-3-hydroxy-4-(methylsulfonylsulfanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CSS(C)(=O)=O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H21NO5S2/c1-11(2,3)17-10(14)12-5-8(9(13)6-12)7-18-19(4,15)16/h8-9,13H,5-7H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | UGVAOQMOMBSHFF-BDAKNGLRSA-N |
| XLogP | 0.91 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|