C15H28N2O5S — CID 126823150
tert-butyl 2-[[cyclopropylmethyl(methyl)sulfamoyl]methyl]morpholine-4-carboxylate (PubChem CID 126823150) has the molecular formula C15H28N2O5S and a molecular weight of 348.47 g/mol. Its IUPAC name is tert-butyl 2-[[cyclopropylmethyl(methyl)sulfamoyl]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[cyclopropylmethyl(methyl)sulfamoyl]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 126823150 |
| Molecular Formula | C15H28N2O5S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | tert-butyl 2-[[cyclopropylmethyl(methyl)sulfamoyl]methyl]morpholine-4-carboxylate |
| SMILES | CN(CC1CC1)S(=O)(=O)CC1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C15H28N2O5S/c1-15(2,3)22-14(18)17-7-8-21-13(10-17)11-23(19,20)16(4)9-12-5-6-12/h12-13H,5-11H2,1-4H3 |
| InChIKey | GFKLOWFILLMINK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |