C14H21Cl3N4O6 — CID 123628570
tert-butyl (2S)-2-ethylmorpholine-4-carboxylate;1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione (PubChem CID 123628570) has the molecular formula C14H21Cl3N4O6 and a molecular weight of 447.70 g/mol. Its IUPAC name is tert-butyl (2S)-2-ethylmorpholine-4-carboxylate;1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione.
| Compound Name | tert-butyl (2S)-2-ethylmorpholine-4-carboxylate;1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 123628570 |
| Molecular Formula | C14H21Cl3N4O6 |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | tert-butyl (2S)-2-ethylmorpholine-4-carboxylate;1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC[C@H]1CN(C(=O)OC(C)(C)C)CCO1.O=c1n(Cl)c(=O)n(Cl)c(=O)n1Cl |
| InChI | InChI=1S/C11H21NO3.C3Cl3N3O3/c1-5-9-8-12(6-7-14-9)10(13)15-11(2,3)4;4-7-1(10)8(5)3(12)9(6)2(7)11/h9H,5-8H2,1-4H3;/t9-;/m0./s1 |
| InChIKey | XJEZXPNUXLSDAO-FVGYRXGTSA-N |
| XLogP | 1.21 |
| TPSA | 104.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |