C12H23NO3 — CID 159190237
tert-butyl 7-ethyl-1,4-oxazepane-4-carboxylate (PubChem CID 159190237) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl 7-ethyl-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl 7-ethyl-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 159190237 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl 7-ethyl-1,4-oxazepane-4-carboxylate |
| SMILES | CCC1CCN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C12H23NO3/c1-5-10-6-7-13(8-9-15-10)11(14)16-12(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | XRWLSHGFIOJGAP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |