C25H30N2O2S2 — CID 22026025
N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylthiophene-2-sulfonamide (PubChem CID 22026025) has the molecular formula C25H30N2O2S2 and a molecular weight of 454.66 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylthiophene-2-sulfonamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22026025 |
| Molecular Formula | C25H30N2O2S2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1cccs1)N(CCCN1CCC(Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O2S2/c28-31(29,25-13-7-20-30-25)27(24-11-5-2-6-12-24)17-8-16-26-18-14-23(15-19-26)21-22-9-3-1-4-10-22/h1-7,9-13,20,23H,8,14-19,21H2 |
| InChIKey | OTWMUHBHTJQZLJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |