C29H39N3O2 — CID 3013679
1-acetyl-N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 3013679) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 1-acetyl-N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-acetyl-N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3013679 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 1-acetyl-N-[3-(4-benzylpiperidin-1-yl)propyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | CC(=O)N1CCCC(C(=O)N(CCCN2CCC(Cc3ccccc3)CC2)c2ccccc2)C1 |
| InChI | InChI=1S/C29H39N3O2/c1-24(33)31-18-8-12-27(23-31)29(34)32(28-13-6-3-7-14-28)19-9-17-30-20-15-26(16-21-30)22-25-10-4-2-5-11-25/h2-7,10-11,13-14,26-27H,8-9,12,15-23H2,1H3 |
| InChIKey | KFGBXLLLMOKTTM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |