C28H33Cl2N3O — CID 22676695
1-[3-(4-benzylpiperidin-1-yl)propyl]-3-(3-chlorophenyl)-1-phenylurea;hydrochloride (PubChem CID 22676695) has the molecular formula C28H33Cl2N3O and a molecular weight of 498.50 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperidin-1-yl)propyl]-3-(3-chlorophenyl)-1-phenylurea;hydrochloride.
| Compound Name | 1-[3-(4-benzylpiperidin-1-yl)propyl]-3-(3-chlorophenyl)-1-phenylurea;hydrochloride |
|---|---|
| PubChem CID | 22676695 |
| Molecular Formula | C28H33Cl2N3O |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-[3-(4-benzylpiperidin-1-yl)propyl]-3-(3-chlorophenyl)-1-phenylurea;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(Cl)c1)N(CCCN1CCC(Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H32ClN3O.ClH/c29-25-11-7-12-26(22-25)30-28(33)32(27-13-5-2-6-14-27)18-8-17-31-19-15-24(16-20-31)21-23-9-3-1-4-10-23;/h1-7,9-14,22,24H,8,15-21H2,(H,30,33);1H |
| InChIKey | YMRRWNYSRIIWQJ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |