C28H30ClN3O — CID 6071298
1-(1-benzylpiperidin-4-yl)-3-(3-chlorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea (PubChem CID 6071298) has the molecular formula C28H30ClN3O and a molecular weight of 460.02 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(3-chlorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(3-chlorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 6071298 |
| Molecular Formula | C28H30ClN3O |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(3-chlorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)N(C/C=C/c1ccccc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H30ClN3O/c29-25-14-7-15-26(21-25)30-28(33)32(18-8-13-23-9-3-1-4-10-23)27-16-19-31(20-17-27)22-24-11-5-2-6-12-24/h1-15,21,27H,16-20,22H2,(H,30,33)/b13-8+ |
| InChIKey | FINHPUGAJBCCCS-MDWZMJQESA-N |
| XLogP | 6.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |