C29H40N4O2 — CID 4271273
N-(1-benzylpiperidin-4-yl)-3-[cyclohexyl-[(3-methylphenyl)carbamoyl]amino]propanamide (PubChem CID 4271273) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-[cyclohexyl-[(3-methylphenyl)carbamoyl]amino]propanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-[cyclohexyl-[(3-methylphenyl)carbamoyl]amino]propanamide |
|---|---|
| PubChem CID | 4271273 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-[cyclohexyl-[(3-methylphenyl)carbamoyl]amino]propanamide |
| SMILES | Cc1cccc(NC(=O)N(CCC(=O)NC2CCN(Cc3ccccc3)CC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C29H40N4O2/c1-23-9-8-12-26(21-23)31-29(35)33(27-13-6-3-7-14-27)20-17-28(34)30-25-15-18-32(19-16-25)22-24-10-4-2-5-11-24/h2,4-5,8-12,21,25,27H,3,6-7,13-20,22H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | CFBWWBOMAAFXPU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |