C28H37BrN4O2 — CID 42700266
N-(1-benzylpiperidin-4-yl)-3-[(4-bromophenyl)carbamoyl-cyclohexylamino]propanamide (PubChem CID 42700266) has the molecular formula C28H37BrN4O2 and a molecular weight of 541.53 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-[(4-bromophenyl)carbamoyl-cyclohexylamino]propanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-[(4-bromophenyl)carbamoyl-cyclohexylamino]propanamide |
|---|---|
| PubChem CID | 42700266 |
| Molecular Formula | C28H37BrN4O2 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-[(4-bromophenyl)carbamoyl-cyclohexylamino]propanamide |
| SMILES | O=C(CCN(C(=O)Nc1ccc(Br)cc1)C1CCCCC1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H37BrN4O2/c29-23-11-13-24(14-12-23)31-28(35)33(26-9-5-2-6-10-26)20-17-27(34)30-25-15-18-32(19-16-25)21-22-7-3-1-4-8-22/h1,3-4,7-8,11-14,25-26H,2,5-6,9-10,15-21H2,(H,30,34)(H,31,35) |
| InChIKey | IHQYWCGPDFRAMY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |