C19H30BrN3O — CID 119899075
7-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]heptanamide (PubChem CID 119899075) has the molecular formula C19H30BrN3O and a molecular weight of 396.37 g/mol. Its IUPAC name is 7-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]heptanamide.
| Compound Name | 7-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]heptanamide |
|---|---|
| PubChem CID | 119899075 |
| Molecular Formula | C19H30BrN3O |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 7-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]heptanamide |
| SMILES | NCCCCCCC(=O)NC1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H30BrN3O/c20-17-8-6-16(7-9-17)15-23-13-10-18(11-14-23)22-19(24)5-3-1-2-4-12-21/h6-9,18H,1-5,10-15,21H2,(H,22,24) |
| InChIKey | HCUMHEMDARHCJZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|