C17H26BrN3O — CID 119899083
N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(methylamino)butanamide (PubChem CID 119899083) has the molecular formula C17H26BrN3O and a molecular weight of 368.32 g/mol. Its IUPAC name is N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(methylamino)butanamide.
| Compound Name | N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119899083 |
| Molecular Formula | C17H26BrN3O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NC1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C17H26BrN3O/c1-19-10-2-3-17(22)20-16-8-11-21(12-9-16)13-14-4-6-15(18)7-5-14/h4-7,16,19H,2-3,8-13H2,1H3,(H,20,22) |
| InChIKey | VSXIFPNPMCKHEZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|