C16H26BrCl2N3O — CID 119899114
4-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]butanamide;dihydrochloride (PubChem CID 119899114) has the molecular formula C16H26BrCl2N3O and a molecular weight of 427.21 g/mol. Its IUPAC name is 4-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]butanamide;dihydrochloride.
| Compound Name | 4-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119899114 |
| Molecular Formula | C16H26BrCl2N3O |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-amino-N-[1-[(4-bromophenyl)methyl]piperidin-4-yl]butanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)NC1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H24BrN3O.2ClH/c17-14-5-3-13(4-6-14)12-20-10-7-15(8-11-20)19-16(21)2-1-9-18;;/h3-6,15H,1-2,7-12,18H2,(H,19,21);2*1H |
| InChIKey | FTHXFCIFRCCADU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |