C17H28Cl2N4O2 — CID 119840358
4-amino-N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]butanamide;dihydrochloride (PubChem CID 119840358) has the molecular formula C17H28Cl2N4O2 and a molecular weight of 391.34 g/mol. Its IUPAC name is 4-amino-N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]butanamide;dihydrochloride.
| Compound Name | 4-amino-N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119840358 |
| Molecular Formula | C17H28Cl2N4O2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-amino-N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]butanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)NC1CCN(CC(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N4O2.2ClH/c18-10-4-7-16(22)19-15-8-11-21(12-9-15)13-17(23)20-14-5-2-1-3-6-14;;/h1-3,5-6,15H,4,7-13,18H2,(H,19,22)(H,20,23);2*1H |
| InChIKey | FXPKGUYHHPHFOU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |