C23H28BrN3O3 — CID 32827783
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(3-bromophenoxy)butanamide (PubChem CID 32827783) has the molecular formula C23H28BrN3O3 and a molecular weight of 474.40 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(3-bromophenoxy)butanamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(3-bromophenoxy)butanamide |
|---|---|
| PubChem CID | 32827783 |
| Molecular Formula | C23H28BrN3O3 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(3-bromophenoxy)butanamide |
| SMILES | O=C(CN1CCC(NC(=O)CCCOc2cccc(Br)c2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C23H28BrN3O3/c24-18-6-4-9-21(16-18)30-15-5-10-22(28)25-20-11-13-27(14-12-20)17-23(29)26-19-7-2-1-3-8-19/h1-4,6-9,16,20H,5,10-15,17H2,(H,25,28)(H,26,29) |
| InChIKey | YGRINVBCVVFQGX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|