C21H37Cl2N3O — CID 119845060
7-amino-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]heptanamide;dihydrochloride (PubChem CID 119845060) has the molecular formula C21H37Cl2N3O and a molecular weight of 418.45 g/mol. Its IUPAC name is 7-amino-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119845060 |
| Molecular Formula | C21H37Cl2N3O |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 7-amino-N-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]heptanamide;dihydrochloride |
| SMILES | CC1CCN(Cc2ccc(CNC(=O)CCCCCCN)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C21H35N3O.2ClH/c1-18-11-14-24(15-12-18)17-20-9-7-19(8-10-20)16-23-21(25)6-4-2-3-5-13-22;;/h7-10,18H,2-6,11-17,22H2,1H3,(H,23,25);2*1H |
| InChIKey | HQBDEZPVSPSEGN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|