C28H39N3O3S — CID 3013680
N-[3-(4-benzylpiperidin-1-yl)propyl]-1-methylsulfonyl-N-phenylpiperidine-3-carboxamide (PubChem CID 3013680) has the molecular formula C28H39N3O3S and a molecular weight of 497.71 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-1-methylsulfonyl-N-phenylpiperidine-3-carboxamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-1-methylsulfonyl-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3013680 |
| Molecular Formula | C28H39N3O3S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-1-methylsulfonyl-N-phenylpiperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)N(CCCN2CCC(Cc3ccccc3)CC2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H39N3O3S/c1-35(33,34)30-18-8-12-26(23-30)28(32)31(27-13-6-3-7-14-27)19-9-17-29-20-15-25(16-21-29)22-24-10-4-2-5-11-24/h2-7,10-11,13-14,25-26H,8-9,12,15-23H2,1H3 |
| InChIKey | WHGKGRONELCPPA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |