C22H28N2O3S — CID 142030476
butyl 3-[[N-(thiophene-2-carbonyl)anilino]methyl]piperidine-1-carboxylate (PubChem CID 142030476) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is butyl 3-[[N-(thiophene-2-carbonyl)anilino]methyl]piperidine-1-carboxylate.
| Compound Name | butyl 3-[[N-(thiophene-2-carbonyl)anilino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142030476 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | butyl 3-[[N-(thiophene-2-carbonyl)anilino]methyl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC(CN(C(=O)c2cccs2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H28N2O3S/c1-2-3-14-27-22(26)23-13-7-9-18(16-23)17-24(19-10-5-4-6-11-19)21(25)20-12-8-15-28-20/h4-6,8,10-12,15,18H,2-3,7,9,13-14,16-17H2,1H3 |
| InChIKey | MVOIXYGXXRKPQJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|